About 4-chloro-2-oxo-1,3-dihydropyrrolo[2,3-b]pyridine-5-carbonitrile
4-chloro-2-oxo-1,3-dihydropyrrolo[2,3-b]pyridine-5-carbonitrile (PubChem CID 166108958) has the molecular formula C8H4ClN3O
and a molecular weight of 193.59 g/mol. Its IUPAC name is 4-chloro-2-oxo-1,3-dihydropyrrolo[2,3-b]pyridine-5-carbonitrile.
Molecular Properties
| Compound Name | 4-chloro-2-oxo-1,3-dihydropyrrolo[2,3-b]pyridine-5-carbonitrile |
| PubChem CID | 166108958 |
| Molecular Formula | C8H4ClN3O |
| Molecular Weight | 193.59 g/mol |
| Exact Mass | 193.00 |
| IUPAC Name | 4-chloro-2-oxo-1,3-dihydropyrrolo[2,3-b]pyridine-5-carbonitrile |
| SMILES | N#Cc1cnc2c(c1Cl)CC(=O)N2 |
| InChI | InChI=1S/C8H4ClN3O/c9-7-4(2-10)3-11-8-5(7)1-6(13)12-8/h3H,1H2,(H,11,12,13) |
| InChIKey | UDJOYMLHXYZFOE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.59 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-2-oxo-1,3-dihydropyrrolo[2,3-b]pyridine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-oxo-1,3-dihydropyrrolo[2,3-b]pyridine-5-carbonitrile?
The IUPAC name of 4-chloro-2-oxo-1,3-dihydropyrrolo[2,3-b]pyridine-5-carbonitrile (CID 166108958) is 4-chloro-2-oxo-1,3-dihydropyrrolo[2,3-b]pyridine-5-carbonitrile.
What is the SMILES notation for 4-chloro-2-oxo-1,3-dihydropyrrolo[2,3-b]pyridine-5-carbonitrile?
The canonical SMILES for 4-chloro-2-oxo-1,3-dihydropyrrolo[2,3-b]pyridine-5-carbonitrile is N#Cc1cnc2c(c1Cl)CC(=O)N2.
What is the InChIKey of 4-chloro-2-oxo-1,3-dihydropyrrolo[2,3-b]pyridine-5-carbonitrile?
The InChIKey is UDJOYMLHXYZFOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClN3O/c9-7-4(2-10)3-11-8-5(7)1-6(13)12-8/h3H,1H2,(H,11,12,13).
What are the key properties of 4-chloro-2-oxo-1,3-dihydropyrrolo[2,3-b]pyridine-5-carbonitrile?
4-chloro-2-oxo-1,3-dihydropyrrolo[2,3-b]pyridine-5-carbonitrile has a molecular weight of 193.59 g/mol, XLogP of 1.10, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-oxo-1,3-dihydropyrrolo[2,3-b]pyridine-5-carbonitrile is sourced from PubChem (CID 166108958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).