C19H29ClO2S — CID 166109094
ethyl (Z,4E)-4-(1-chloroethylidene)-2-[1-[(2E,4Z)-hexa-2,4-dien-2-yl]sulfanylethyl]hept-5-enoate (PubChem CID 166109094) has the molecular formula C19H29ClO2S and a molecular weight of 356.96 g/mol. Its IUPAC name is ethyl (Z,4E)-4-(1-chloroethylidene)-2-[1-[(2E,4Z)-hexa-2,4-dien-2-yl]sulfanylethyl]hept-5-enoate.
| Compound Name | ethyl (Z,4E)-4-(1-chloroethylidene)-2-[1-[(2E,4Z)-hexa-2,4-dien-2-yl]sulfanylethyl]hept-5-enoate |
|---|---|
| PubChem CID | 166109094 |
| Molecular Formula | C19H29ClO2S |
| Molecular Weight | 356.96 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | ethyl (Z,4E)-4-(1-chloroethylidene)-2-[1-[(2E,4Z)-hexa-2,4-dien-2-yl]sulfanylethyl]hept-5-enoate |
| SMILES | C/C=C\C=C(/C)SC(C)C(CC(/C=C\C)=C(/C)Cl)C(=O)OCC |
| InChI | InChI=1S/C19H29ClO2S/c1-7-10-12-14(4)23-16(6)18(19(21)22-9-3)13-17(11-8-2)15(5)20/h7-8,10-12,16,18H,9,13H2,1-6H3/b10-7-,11-8-,14-12+,17-15- |
| InChIKey | CPPVHUMPBPXQRI-XENDKWNOSA-N |
| XLogP | 6.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.96 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|