C14H10F3N5O2S2 — CID 166109312
N-(1,3-thiazol-2-yl)-2-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxamide (PubChem CID 166109312) has the molecular formula C14H10F3N5O2S2 and a molecular weight of 401.40 g/mol. Its IUPAC name is N-(1,3-thiazol-2-yl)-2-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxamide.
| Compound Name | N-(1,3-thiazol-2-yl)-2-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 166109312 |
| Molecular Formula | C14H10F3N5O2S2 |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | N-(1,3-thiazol-2-yl)-2-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxamide |
| SMILES | O=C(Nc1nccs1)N1CCc2cc(-c3noc(C(F)(F)F)n3)sc2C1 |
| InChI | InChI=1S/C14H10F3N5O2S2/c15-14(16,17)11-19-10(21-24-11)8-5-7-1-3-22(6-9(7)26-8)13(23)20-12-18-2-4-25-12/h2,4-5H,1,3,6H2,(H,18,20,23) |
| InChIKey | OWVQUWVEBLGIQC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |