C19H16ClF5N4O3 — CID 166110742
N-[(3-chloro-2,4-difluorophenyl)-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-3-oxopiperazine-1-carboxamide (PubChem CID 166110742) has the molecular formula C19H16ClF5N4O3 and a molecular weight of 478.81 g/mol. Its IUPAC name is N-[(3-chloro-2,4-difluorophenyl)-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-3-oxopiperazine-1-carboxamide.
| Compound Name | N-[(3-chloro-2,4-difluorophenyl)-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-3-oxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 166110742 |
| Molecular Formula | C19H16ClF5N4O3 |
| Molecular Weight | 478.81 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | N-[(3-chloro-2,4-difluorophenyl)-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-3-oxopiperazine-1-carboxamide |
| SMILES | O=C1CN(C(=O)NC(c2ccc(OCC(F)(F)F)nc2)c2ccc(F)c(Cl)c2F)CCN1 |
| InChI | InChI=1S/C19H16ClF5N4O3/c20-15-12(21)3-2-11(16(15)22)17(28-18(31)29-6-5-26-13(30)8-29)10-1-4-14(27-7-10)32-9-19(23,24)25/h1-4,7,17H,5-6,8-9H2,(H,26,30)(H,28,31) |
| InChIKey | JYQBWFQLDLQWDI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.81 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|