C25H19ClF2N2O4 — CID 166111360
6-chloro-3-[1-[2-(3,4-difluorophenyl)-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]pyridine-2-carboxylic acid (PubChem CID 166111360) has the molecular formula C25H19ClF2N2O4 and a molecular weight of 484.89 g/mol. Its IUPAC name is 6-chloro-3-[1-[2-(3,4-difluorophenyl)-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]pyridine-2-carboxylic acid.
| Compound Name | 6-chloro-3-[1-[2-(3,4-difluorophenyl)-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 166111360 |
| Molecular Formula | C25H19ClF2N2O4 |
| Molecular Weight | 484.89 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 6-chloro-3-[1-[2-(3,4-difluorophenyl)-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]pyridine-2-carboxylic acid |
| SMILES | Cc1cc(C(C)Nc2ccc(Cl)nc2C(=O)O)c2oc(-c3ccc(F)c(F)c3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C25H19ClF2N2O4/c1-11-8-15(13(3)29-19-6-7-20(26)30-21(19)25(32)33)24-16(9-11)22(31)12(2)23(34-24)14-4-5-17(27)18(28)10-14/h4-10,13,29H,1-3H3,(H,32,33) |
| InChIKey | FKNLWKYWZFPAME-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.89 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|