About 2-[4,5-dimethyl-2-(6-methyl-2-pyridinyl)pyrazol-3-yl]thieno[2,3-b]pyridine
2-[4,5-dimethyl-2-(6-methyl-2-pyridinyl)pyrazol-3-yl]thieno[2,3-b]pyridine (PubChem CID 166112324) has the molecular formula C18H16N4S
and a molecular weight of 320.42 g/mol. Its IUPAC name is 2-[4,5-dimethyl-2-(6-methyl-2-pyridinyl)pyrazol-3-yl]thieno[2,3-b]pyridine.
Molecular Properties
| Compound Name | 2-[4,5-dimethyl-2-(6-methyl-2-pyridinyl)pyrazol-3-yl]thieno[2,3-b]pyridine |
| PubChem CID | 166112324 |
| Molecular Formula | C18H16N4S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-[4,5-dimethyl-2-(6-methyl-2-pyridinyl)pyrazol-3-yl]thieno[2,3-b]pyridine |
| SMILES | Cc1cccc(-n2nc(C)c(C)c2-c2cc3cccnc3s2)n1 |
| InChI | InChI=1S/C18H16N4S/c1-11-6-4-8-16(20-11)22-17(12(2)13(3)21-22)15-10-14-7-5-9-19-18(14)23-15/h4-10H,1-3H3 |
| InChIKey | PKXOPOZNMQZGMR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4,5-dimethyl-2-(6-methyl-2-pyridinyl)pyrazol-3-yl]thieno[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4,5-dimethyl-2-(6-methyl-2-pyridinyl)pyrazol-3-yl]thieno[2,3-b]pyridine?
The IUPAC name of 2-[4,5-dimethyl-2-(6-methyl-2-pyridinyl)pyrazol-3-yl]thieno[2,3-b]pyridine (CID 166112324) is 2-[4,5-dimethyl-2-(6-methyl-2-pyridinyl)pyrazol-3-yl]thieno[2,3-b]pyridine.
What is the SMILES notation for 2-[4,5-dimethyl-2-(6-methyl-2-pyridinyl)pyrazol-3-yl]thieno[2,3-b]pyridine?
The canonical SMILES for 2-[4,5-dimethyl-2-(6-methyl-2-pyridinyl)pyrazol-3-yl]thieno[2,3-b]pyridine is Cc1cccc(-n2nc(C)c(C)c2-c2cc3cccnc3s2)n1.
What is the InChIKey of 2-[4,5-dimethyl-2-(6-methyl-2-pyridinyl)pyrazol-3-yl]thieno[2,3-b]pyridine?
The InChIKey is PKXOPOZNMQZGMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4S/c1-11-6-4-8-16(20-11)22-17(12(2)13(3)21-22)15-10-14-7-5-9-19-18(14)23-15/h4-10H,1-3H3.
What are the key properties of 2-[4,5-dimethyl-2-(6-methyl-2-pyridinyl)pyrazol-3-yl]thieno[2,3-b]pyridine?
2-[4,5-dimethyl-2-(6-methyl-2-pyridinyl)pyrazol-3-yl]thieno[2,3-b]pyridine has a molecular weight of 320.42 g/mol, XLogP of 4.47, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,5-dimethyl-2-(6-methyl-2-pyridinyl)pyrazol-3-yl]thieno[2,3-b]pyridine is sourced from PubChem (CID 166112324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).