C13H20N2O2 — CID 166112677
3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)piperidine-2,6-dione (PubChem CID 166112677) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)piperidine-2,6-dione.
| Compound Name | 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 166112677 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)piperidine-2,6-dione |
| SMILES | CC(C)N1CCC=C(C2CCC(=O)NC2=O)C1 |
| InChI | InChI=1S/C13H20N2O2/c1-9(2)15-7-3-4-10(8-15)11-5-6-12(16)14-13(11)17/h4,9,11H,3,5-8H2,1-2H3,(H,14,16,17) |
| InChIKey | XDEQVQNOGFFFTA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|