C17H32FN3O — CID 166113225
1-[4-[(1-butan-2-yl-4-fluoropiperidin-4-yl)methyl]piperazin-1-yl]propan-1-one (PubChem CID 166113225) has the molecular formula C17H32FN3O and a molecular weight of 313.46 g/mol. Its IUPAC name is 1-[4-[(1-butan-2-yl-4-fluoropiperidin-4-yl)methyl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-[4-[(1-butan-2-yl-4-fluoropiperidin-4-yl)methyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 166113225 |
| Molecular Formula | C17H32FN3O |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | 1-[4-[(1-butan-2-yl-4-fluoropiperidin-4-yl)methyl]piperazin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCN(CC2(F)CCN(C(C)CC)CC2)CC1 |
| InChI | InChI=1S/C17H32FN3O/c1-4-15(3)20-8-6-17(18,7-9-20)14-19-10-12-21(13-11-19)16(22)5-2/h15H,4-14H2,1-3H3 |
| InChIKey | FEDRELZIRRRSBU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |