C18H29BrN2O2 — CID 166113585
tert-butyl 2-[1-(5-bromo-2-pyridinyl)piperidin-4-yl]acetate;ethane (PubChem CID 166113585) has the molecular formula C18H29BrN2O2 and a molecular weight of 385.35 g/mol. Its IUPAC name is tert-butyl 2-[1-(5-bromo-2-pyridinyl)piperidin-4-yl]acetate;ethane.
| Compound Name | tert-butyl 2-[1-(5-bromo-2-pyridinyl)piperidin-4-yl]acetate;ethane |
|---|---|
| PubChem CID | 166113585 |
| Molecular Formula | C18H29BrN2O2 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | tert-butyl 2-[1-(5-bromo-2-pyridinyl)piperidin-4-yl]acetate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)CC1CCN(c2ccc(Br)cn2)CC1 |
| InChI | InChI=1S/C16H23BrN2O2.C2H6/c1-16(2,3)21-15(20)10-12-6-8-19(9-7-12)14-5-4-13(17)11-18-14;1-2/h4-5,11-12H,6-10H2,1-3H3;1-2H3 |
| InChIKey | HIUKPJHVUXQGPW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |