About CID 166114905
CID 166114905 (PubChem CID 166114905) has the molecular formula C8H11N2Rb
and a molecular weight of 220.66 g/mol.
Molecular Properties
| Compound Name | CID 166114905 |
| PubChem CID | 166114905 |
| Molecular Formula | C8H11N2Rb |
| Molecular Weight | 220.66 g/mol |
| Exact Mass | 220.00 |
| IUPAC Name | — |
| SMILES | CC(C)C1=NC=[C-]CC=N1.[Rb+] |
| InChI | InChI=1S/C8H11N2.Rb/c1-7(2)8-9-5-3-4-6-10-8;/h5-7H,3H2,1-2H3;/q-1;+1 |
| InChIKey | JUINZPDDNNICMH-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.66 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 166114905 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166114905?
The IUPAC name of CID 166114905 (CID 166114905) is not available.
What is the SMILES notation for CID 166114905?
The canonical SMILES for CID 166114905 is CC(C)C1=NC=[C-]CC=N1.[Rb+].
What is the InChIKey of CID 166114905?
The InChIKey is JUINZPDDNNICMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N2.Rb/c1-7(2)8-9-5-3-4-6-10-8;/h5-7H,3H2,1-2H3;/q-1;+1.
What are the key properties of CID 166114905?
CID 166114905 has a molecular weight of 220.66 g/mol, XLogP of -1.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166114905 is sourced from PubChem (CID 166114905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).