C14H25F3N4O — CID 166115518
N,N,4-trimethyl-1-(2,2,2-trifluoroethyl)-1,4,9-triazaspiro[5.5]undecane-9-carboxamide (PubChem CID 166115518) has the molecular formula C14H25F3N4O and a molecular weight of 322.38 g/mol. Its IUPAC name is N,N,4-trimethyl-1-(2,2,2-trifluoroethyl)-1,4,9-triazaspiro[5.5]undecane-9-carboxamide.
| Compound Name | N,N,4-trimethyl-1-(2,2,2-trifluoroethyl)-1,4,9-triazaspiro[5.5]undecane-9-carboxamide |
|---|---|
| PubChem CID | 166115518 |
| Molecular Formula | C14H25F3N4O |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | N,N,4-trimethyl-1-(2,2,2-trifluoroethyl)-1,4,9-triazaspiro[5.5]undecane-9-carboxamide |
| SMILES | CN1CCN(CC(F)(F)F)C2(CCN(C(=O)N(C)C)CC2)C1 |
| InChI | InChI=1S/C14H25F3N4O/c1-18(2)12(22)20-6-4-13(5-7-20)10-19(3)8-9-21(13)11-14(15,16)17/h4-11H2,1-3H3 |
| InChIKey | GTUXELWZNQRKCQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |