About 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-carboxamide;ethane
4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-carboxamide;ethane (PubChem CID 166115656) has the molecular formula C12H26N4O
and a molecular weight of 242.37 g/mol. Its IUPAC name is 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-carboxamide;ethane.
Molecular Properties
| Compound Name | 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-carboxamide;ethane |
| PubChem CID | 166115656 |
| Molecular Formula | C12H26N4O |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-carboxamide;ethane |
| SMILES | CC.CN(C)C(=O)N1CCN(C2CNC2)CC1 |
| InChI | InChI=1S/C10H20N4O.C2H6/c1-12(2)10(15)14-5-3-13(4-6-14)9-7-11-8-9;1-2/h9,11H,3-8H2,1-2H3;1-2H3 |
| InChIKey | MVTNRIMDPKNUEY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-carboxamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-carboxamide;ethane?
The IUPAC name of 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-carboxamide;ethane (CID 166115656) is 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-carboxamide;ethane.
What is the SMILES notation for 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-carboxamide;ethane?
The canonical SMILES for 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-carboxamide;ethane is CC.CN(C)C(=O)N1CCN(C2CNC2)CC1.
What is the InChIKey of 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-carboxamide;ethane?
The InChIKey is MVTNRIMDPKNUEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4O.C2H6/c1-12(2)10(15)14-5-3-13(4-6-14)9-7-11-8-9;1-2/h9,11H,3-8H2,1-2H3;1-2H3.
What are the key properties of 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-carboxamide;ethane?
4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-carboxamide;ethane has a molecular weight of 242.37 g/mol, XLogP of 0.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-carboxamide;ethane is sourced from PubChem (CID 166115656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).