C18H29N3O5 — CID 166115821
(2S)-3-methyl-2-[methyl-(4-prop-2-enoyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carbonyl)amino]butanoic acid (PubChem CID 166115821) has the molecular formula C18H29N3O5 and a molecular weight of 367.45 g/mol. Its IUPAC name is (2S)-3-methyl-2-[methyl-(4-prop-2-enoyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carbonyl)amino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[methyl-(4-prop-2-enoyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 166115821 |
| Molecular Formula | C18H29N3O5 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (2S)-3-methyl-2-[methyl-(4-prop-2-enoyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carbonyl)amino]butanoic acid |
| SMILES | C=CC(=O)N1CCOC2(CCN(C(=O)N(C)[C@H](C(=O)O)C(C)C)CC2)C1 |
| InChI | InChI=1S/C18H29N3O5/c1-5-14(22)21-10-11-26-18(12-21)6-8-20(9-7-18)17(25)19(4)15(13(2)3)16(23)24/h5,13,15H,1,6-12H2,2-4H3,(H,23,24)/t15-/m0/s1 |
| InChIKey | KJDIOZMTTDLYQD-HNNXBMFYSA-N |
| XLogP | 1.03 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|