C28H33F5N6O5S — CID 166116678
[4-[4-[4-[[(5-tert-butyl-1,2,4-oxadiazole-3-carbonyl)amino]methyl]-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]-2,2-difluorobutyl] trifluoromethanesulfonate;ethane (PubChem CID 166116678) has the molecular formula C28H33F5N6O5S and a molecular weight of 660.67 g/mol. Its IUPAC name is [4-[4-[4-[[(5-tert-butyl-1,2,4-oxadiazole-3-carbonyl)amino]methyl]-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]-2,2-difluorobutyl] trifluoromethanesulfonate;ethane.
| Compound Name | [4-[4-[4-[[(5-tert-butyl-1,2,4-oxadiazole-3-carbonyl)amino]methyl]-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]-2,2-difluorobutyl] trifluoromethanesulfonate;ethane |
|---|---|
| PubChem CID | 166116678 |
| Molecular Formula | C28H33F5N6O5S |
| Molecular Weight | 660.67 g/mol |
| Exact Mass | 660.22 |
| IUPAC Name | [4-[4-[4-[[(5-tert-butyl-1,2,4-oxadiazole-3-carbonyl)amino]methyl]-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]-2,2-difluorobutyl] trifluoromethanesulfonate;ethane |
| SMILES | CC.Cc1cc(-c2ncnn3cc(CCC(F)(F)COS(=O)(=O)C(F)(F)F)cc23)ccc1CNC(=O)c1noc(C(C)(C)C)n1 |
| InChI | InChI=1S/C26H27F5N6O5S.C2H6/c1-15-9-17(5-6-18(15)11-32-22(38)21-35-23(42-36-21)24(2,3)4)20-19-10-16(12-37(19)34-14-33-20)7-8-25(27,28)13-41-43(39,40)26(29,30)31;1-2/h5-6,9-10,12,14H,7-8,11,13H2,1-4H3,(H,32,38);1-2H3 |
| InChIKey | LPTAWMLTCLTNBL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 141.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.67 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|