C40H44N6O5 — CID 166116787
tert-butyl N-[[4-[6-[4-[3-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]propoxymethyl]phenyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2-methylphenyl]methyl]carbamate (PubChem CID 166116787) has the molecular formula C40H44N6O5 and a molecular weight of 688.83 g/mol. Its IUPAC name is tert-butyl N-[[4-[6-[4-[3-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]propoxymethyl]phenyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2-methylphenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[6-[4-[3-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]propoxymethyl]phenyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2-methylphenyl]methyl]carbamate |
|---|---|
| PubChem CID | 166116787 |
| Molecular Formula | C40H44N6O5 |
| Molecular Weight | 688.83 g/mol |
| Exact Mass | 688.34 |
| IUPAC Name | tert-butyl N-[[4-[6-[4-[3-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]propoxymethyl]phenyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2-methylphenyl]methyl]carbamate |
| SMILES | Cc1cc(-c2ncnn3cc(-c4ccc(COCCCc5ccc(NC6CCC(=O)NC6=O)cc5)cc4)cc23)ccc1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C40H44N6O5/c1-26-20-30(13-14-31(26)22-41-39(49)51-40(2,3)4)37-35-21-32(23-46(35)43-25-42-37)29-11-7-28(8-12-29)24-50-19-5-6-27-9-15-33(16-10-27)44-34-17-18-36(47)45-38(34)48/h7-16,20-21,23,25,34,44H,5-6,17-19,22,24H2,1-4H3,(H,41,49)(H,45,47,48) |
| InChIKey | HCTPMWJFNCYQRB-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 135.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.83 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|