C21H37N5O2 — CID 166116797
ethane;3-[[5-(1-propan-2-ylpiperidin-4-yl)pyrimidin-2-yl]amino]piperidine-2,6-dione (PubChem CID 166116797) has the molecular formula C21H37N5O2 and a molecular weight of 391.56 g/mol. Its IUPAC name is ethane;3-[[5-(1-propan-2-ylpiperidin-4-yl)pyrimidin-2-yl]amino]piperidine-2,6-dione.
| Compound Name | ethane;3-[[5-(1-propan-2-ylpiperidin-4-yl)pyrimidin-2-yl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166116797 |
| Molecular Formula | C21H37N5O2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.29 |
| IUPAC Name | ethane;3-[[5-(1-propan-2-ylpiperidin-4-yl)pyrimidin-2-yl]amino]piperidine-2,6-dione |
| SMILES | CC.CC.CC(C)N1CCC(c2cnc(NC3CCC(=O)NC3=O)nc2)CC1 |
| InChI | InChI=1S/C17H25N5O2.2C2H6/c1-11(2)22-7-5-12(6-8-22)13-9-18-17(19-10-13)20-14-3-4-15(23)21-16(14)24;2*1-2/h9-12,14H,3-8H2,1-2H3,(H,18,19,20)(H,21,23,24);2*1-2H3 |
| InChIKey | ODKPDPWBGQIPMQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|