C27H23FN6O3 — CID 166117186
5-tert-butyl-N-[[2-fluoro-4-[6-(4-formylphenyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]phenyl]methyl]-1,2,4-oxadiazole-3-carboxamide (PubChem CID 166117186) has the molecular formula C27H23FN6O3 and a molecular weight of 498.52 g/mol. Its IUPAC name is 5-tert-butyl-N-[[2-fluoro-4-[6-(4-formylphenyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]phenyl]methyl]-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 5-tert-butyl-N-[[2-fluoro-4-[6-(4-formylphenyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]phenyl]methyl]-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 166117186 |
| Molecular Formula | C27H23FN6O3 |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 5-tert-butyl-N-[[2-fluoro-4-[6-(4-formylphenyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]phenyl]methyl]-1,2,4-oxadiazole-3-carboxamide |
| SMILES | CC(C)(C)c1nc(C(=O)NCc2ccc(-c3ncnn4cc(-c5ccc(C=O)cc5)cc34)cc2F)no1 |
| InChI | InChI=1S/C27H23FN6O3/c1-27(2,3)26-32-24(33-37-26)25(36)29-12-19-9-8-18(10-21(19)28)23-22-11-20(13-34(22)31-15-30-23)17-6-4-16(14-35)5-7-17/h4-11,13-15H,12H2,1-3H3,(H,29,36) |
| InChIKey | WFJVRHXNDBQGDB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|