C31H39N7O — CID 166117360
2-[4-[1-[4-[7-[4-(aminomethyl)-3-methylphenyl]pyrazolo[1,5-a]pyrimidin-2-yl]butyl]piperidin-4-yl]anilino]acetamide (PubChem CID 166117360) has the molecular formula C31H39N7O and a molecular weight of 525.70 g/mol. Its IUPAC name is 2-[4-[1-[4-[7-[4-(aminomethyl)-3-methylphenyl]pyrazolo[1,5-a]pyrimidin-2-yl]butyl]piperidin-4-yl]anilino]acetamide.
| Compound Name | 2-[4-[1-[4-[7-[4-(aminomethyl)-3-methylphenyl]pyrazolo[1,5-a]pyrimidin-2-yl]butyl]piperidin-4-yl]anilino]acetamide |
|---|---|
| PubChem CID | 166117360 |
| Molecular Formula | C31H39N7O |
| Molecular Weight | 525.70 g/mol |
| Exact Mass | 525.32 |
| IUPAC Name | 2-[4-[1-[4-[7-[4-(aminomethyl)-3-methylphenyl]pyrazolo[1,5-a]pyrimidin-2-yl]butyl]piperidin-4-yl]anilino]acetamide |
| SMILES | Cc1cc(-c2ccnc3cc(CCCCN4CCC(c5ccc(NCC(N)=O)cc5)CC4)nn23)ccc1CN |
| InChI | InChI=1S/C31H39N7O/c1-22-18-25(5-6-26(22)20-32)29-11-14-34-31-19-28(36-38(29)31)4-2-3-15-37-16-12-24(13-17-37)23-7-9-27(10-8-23)35-21-30(33)39/h5-11,14,18-19,24,35H,2-4,12-13,15-17,20-21,32H2,1H3,(H2,33,39) |
| InChIKey | KCVOAKXBYLHXRA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 114.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.70 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|