About 3-amino-4-cyclohexa-1,5-dien-1-ylbutane-1,2-diol
3-amino-4-cyclohexa-1,5-dien-1-ylbutane-1,2-diol (PubChem CID 166117765) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 3-amino-4-cyclohexa-1,5-dien-1-ylbutane-1,2-diol.
Molecular Properties
| Compound Name | 3-amino-4-cyclohexa-1,5-dien-1-ylbutane-1,2-diol |
| PubChem CID | 166117765 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 3-amino-4-cyclohexa-1,5-dien-1-ylbutane-1,2-diol |
| SMILES | NC(CC1=CCCC=C1)C(O)CO |
| InChI | InChI=1S/C10H17NO2/c11-9(10(13)7-12)6-8-4-2-1-3-5-8/h2,4-5,9-10,12-13H,1,3,6-7,11H2 |
| InChIKey | WTKNAOYHGGTXPB-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-4-cyclohexa-1,5-dien-1-ylbutane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-cyclohexa-1,5-dien-1-ylbutane-1,2-diol?
The IUPAC name of 3-amino-4-cyclohexa-1,5-dien-1-ylbutane-1,2-diol (CID 166117765) is 3-amino-4-cyclohexa-1,5-dien-1-ylbutane-1,2-diol.
What is the SMILES notation for 3-amino-4-cyclohexa-1,5-dien-1-ylbutane-1,2-diol?
The canonical SMILES for 3-amino-4-cyclohexa-1,5-dien-1-ylbutane-1,2-diol is NC(CC1=CCCC=C1)C(O)CO.
What is the InChIKey of 3-amino-4-cyclohexa-1,5-dien-1-ylbutane-1,2-diol?
The InChIKey is WTKNAOYHGGTXPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c11-9(10(13)7-12)6-8-4-2-1-3-5-8/h2,4-5,9-10,12-13H,1,3,6-7,11H2.
What are the key properties of 3-amino-4-cyclohexa-1,5-dien-1-ylbutane-1,2-diol?
3-amino-4-cyclohexa-1,5-dien-1-ylbutane-1,2-diol has a molecular weight of 183.25 g/mol, XLogP of 0.33, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-cyclohexa-1,5-dien-1-ylbutane-1,2-diol is sourced from PubChem (CID 166117765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).