C19H16F8S2 — CID 166117781
1,2,4,5-tetrafluoro-3-(2-methylpropylsulfanyl)-6-(2,3,5,6-tetrafluoro-4-propylsulfanylphenyl)benzene (PubChem CID 166117781) has the molecular formula C19H16F8S2 and a molecular weight of 460.46 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-(2-methylpropylsulfanyl)-6-(2,3,5,6-tetrafluoro-4-propylsulfanylphenyl)benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-(2-methylpropylsulfanyl)-6-(2,3,5,6-tetrafluoro-4-propylsulfanylphenyl)benzene |
|---|---|
| PubChem CID | 166117781 |
| Molecular Formula | C19H16F8S2 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-(2-methylpropylsulfanyl)-6-(2,3,5,6-tetrafluoro-4-propylsulfanylphenyl)benzene |
| SMILES | CCCSc1c(F)c(F)c(-c2c(F)c(F)c(SCC(C)C)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C19H16F8S2/c1-4-5-28-18-14(24)10(20)8(11(21)15(18)25)9-12(22)16(26)19(17(27)13(9)23)29-6-7(2)3/h7H,4-6H2,1-3H3 |
| InChIKey | BGQLOBKDDSOYOF-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|