C29H34O7 — CID 166118727
methyl 2-[(1R,2S,4R,6R,9R,10S,11R,15R,18R)-7,9,11,15-tetramethyl-6-(4-methylfuran-3-yl)-12,16-dioxo-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,13-dien-10-yl]propanoate (PubChem CID 166118727) has the molecular formula C29H34O7 and a molecular weight of 494.58 g/mol. Its IUPAC name is methyl 2-[(1R,2S,4R,6R,9R,10S,11R,15R,18R)-7,9,11,15-tetramethyl-6-(4-methylfuran-3-yl)-12,16-dioxo-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,13-dien-10-yl]propanoate.
| Compound Name | methyl 2-[(1R,2S,4R,6R,9R,10S,11R,15R,18R)-7,9,11,15-tetramethyl-6-(4-methylfuran-3-yl)-12,16-dioxo-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,13-dien-10-yl]propanoate |
|---|---|
| PubChem CID | 166118727 |
| Molecular Formula | C29H34O7 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | methyl 2-[(1R,2S,4R,6R,9R,10S,11R,15R,18R)-7,9,11,15-tetramethyl-6-(4-methylfuran-3-yl)-12,16-dioxo-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadeca-7,13-dien-10-yl]propanoate |
| SMILES | COC(=O)C(C)[C@H]1[C@]2(C)C3=C(C)[C@H](c4cocc4C)C[C@H]3O[C@@H]2[C@@H]2OC(=O)[C@]3(C)C=CC(=O)[C@@]1(C)[C@@H]23 |
| InChI | InChI=1S/C29H34O7/c1-13-11-34-12-17(13)16-10-18-20(14(16)2)29(6)22(15(3)25(31)33-7)28(5)19(30)8-9-27(4)23(28)21(24(29)35-18)36-26(27)32/h8-9,11-12,15-16,18,21-24H,10H2,1-7H3/t15?,16-,18-,21-,22-,23+,24-,27-,28-,29+/m1/s1 |
| InChIKey | VGISPCXSKIGVPZ-JXJZHLLSSA-N |
| XLogP | 4.30 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|