About ethane;1-methyl-3-(1,1,1-trifluoro-3-hydroxypropan-2-yl)urea
ethane;1-methyl-3-(1,1,1-trifluoro-3-hydroxypropan-2-yl)urea (PubChem CID 166119207) has the molecular formula C7H15F3N2O2
and a molecular weight of 216.20 g/mol. Its IUPAC name is ethane;1-methyl-3-(1,1,1-trifluoro-3-hydroxypropan-2-yl)urea.
Molecular Properties
| Compound Name | ethane;1-methyl-3-(1,1,1-trifluoro-3-hydroxypropan-2-yl)urea |
| PubChem CID | 166119207 |
| Molecular Formula | C7H15F3N2O2 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | ethane;1-methyl-3-(1,1,1-trifluoro-3-hydroxypropan-2-yl)urea |
| SMILES | CC.CNC(=O)NC(CO)C(F)(F)F |
| InChI | InChI=1S/C5H9F3N2O2.C2H6/c1-9-4(12)10-3(2-11)5(6,7)8;1-2/h3,11H,2H2,1H3,(H2,9,10,12);1-2H3 |
| InChIKey | HGFWJXVMTOSVFF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-methyl-3-(1,1,1-trifluoro-3-hydroxypropan-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-3-(1,1,1-trifluoro-3-hydroxypropan-2-yl)urea?
The IUPAC name of ethane;1-methyl-3-(1,1,1-trifluoro-3-hydroxypropan-2-yl)urea (CID 166119207) is ethane;1-methyl-3-(1,1,1-trifluoro-3-hydroxypropan-2-yl)urea.
What is the SMILES notation for ethane;1-methyl-3-(1,1,1-trifluoro-3-hydroxypropan-2-yl)urea?
The canonical SMILES for ethane;1-methyl-3-(1,1,1-trifluoro-3-hydroxypropan-2-yl)urea is CC.CNC(=O)NC(CO)C(F)(F)F.
What is the InChIKey of ethane;1-methyl-3-(1,1,1-trifluoro-3-hydroxypropan-2-yl)urea?
The InChIKey is HGFWJXVMTOSVFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9F3N2O2.C2H6/c1-9-4(12)10-3(2-11)5(6,7)8;1-2/h3,11H,2H2,1H3,(H2,9,10,12);1-2H3.
What are the key properties of ethane;1-methyl-3-(1,1,1-trifluoro-3-hydroxypropan-2-yl)urea?
ethane;1-methyl-3-(1,1,1-trifluoro-3-hydroxypropan-2-yl)urea has a molecular weight of 216.20 g/mol, XLogP of 0.86, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-3-(1,1,1-trifluoro-3-hydroxypropan-2-yl)urea is sourced from PubChem (CID 166119207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).