About 2-fluoro-N-(2-hydroxyethyl)-N'-methylpropanediamide
2-fluoro-N-(2-hydroxyethyl)-N'-methylpropanediamide (PubChem CID 166119564) has the molecular formula C6H11FN2O3
and a molecular weight of 178.16 g/mol. Its IUPAC name is 2-fluoro-N-(2-hydroxyethyl)-N'-methylpropanediamide.
Molecular Properties
| Compound Name | 2-fluoro-N-(2-hydroxyethyl)-N'-methylpropanediamide |
| PubChem CID | 166119564 |
| Molecular Formula | C6H11FN2O3 |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 2-fluoro-N-(2-hydroxyethyl)-N'-methylpropanediamide |
| SMILES | CNC(=O)C(F)C(=O)NCCO |
| InChI | InChI=1S/C6H11FN2O3/c1-8-5(11)4(7)6(12)9-2-3-10/h4,10H,2-3H2,1H3,(H,8,11)(H,9,12) |
| InChIKey | CYJBPULEXYRWTA-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N-(2-hydroxyethyl)-N'-methylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-(2-hydroxyethyl)-N'-methylpropanediamide?
The IUPAC name of 2-fluoro-N-(2-hydroxyethyl)-N'-methylpropanediamide (CID 166119564) is 2-fluoro-N-(2-hydroxyethyl)-N'-methylpropanediamide.
What is the SMILES notation for 2-fluoro-N-(2-hydroxyethyl)-N'-methylpropanediamide?
The canonical SMILES for 2-fluoro-N-(2-hydroxyethyl)-N'-methylpropanediamide is CNC(=O)C(F)C(=O)NCCO.
What is the InChIKey of 2-fluoro-N-(2-hydroxyethyl)-N'-methylpropanediamide?
The InChIKey is CYJBPULEXYRWTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FN2O3/c1-8-5(11)4(7)6(12)9-2-3-10/h4,10H,2-3H2,1H3,(H,8,11)(H,9,12).
What are the key properties of 2-fluoro-N-(2-hydroxyethyl)-N'-methylpropanediamide?
2-fluoro-N-(2-hydroxyethyl)-N'-methylpropanediamide has a molecular weight of 178.16 g/mol, XLogP of -1.82, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-(2-hydroxyethyl)-N'-methylpropanediamide is sourced from PubChem (CID 166119564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).