About 6-methyl-N-(3-phenylpropyl)-2-pyrimidin-4-ylthieno[2,3-d]pyrimidin-4-amine
6-methyl-N-(3-phenylpropyl)-2-pyrimidin-4-ylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 166119848) has the molecular formula C20H19N5S
and a molecular weight of 361.47 g/mol. Its IUPAC name is 6-methyl-N-(3-phenylpropyl)-2-pyrimidin-4-ylthieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-methyl-N-(3-phenylpropyl)-2-pyrimidin-4-ylthieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 166119848 |
| Molecular Formula | C20H19N5S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 6-methyl-N-(3-phenylpropyl)-2-pyrimidin-4-ylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cc2c(NCCCc3ccccc3)nc(-c3ccncn3)nc2s1 |
| InChI | InChI=1S/C20H19N5S/c1-14-12-16-18(22-10-5-8-15-6-3-2-4-7-15)24-19(25-20(16)26-14)17-9-11-21-13-23-17/h2-4,6-7,9,11-13H,5,8,10H2,1H3,(H,22,24,25) |
| InChIKey | BKXYBLBXXNABOG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-N-(3-phenylpropyl)-2-pyrimidin-4-ylthieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-N-(3-phenylpropyl)-2-pyrimidin-4-ylthieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of 6-methyl-N-(3-phenylpropyl)-2-pyrimidin-4-ylthieno[2,3-d]pyrimidin-4-amine (CID 166119848) is 6-methyl-N-(3-phenylpropyl)-2-pyrimidin-4-ylthieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 6-methyl-N-(3-phenylpropyl)-2-pyrimidin-4-ylthieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 6-methyl-N-(3-phenylpropyl)-2-pyrimidin-4-ylthieno[2,3-d]pyrimidin-4-amine is Cc1cc2c(NCCCc3ccccc3)nc(-c3ccncn3)nc2s1.
What is the InChIKey of 6-methyl-N-(3-phenylpropyl)-2-pyrimidin-4-ylthieno[2,3-d]pyrimidin-4-amine?
The InChIKey is BKXYBLBXXNABOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N5S/c1-14-12-16-18(22-10-5-8-15-6-3-2-4-7-15)24-19(25-20(16)26-14)17-9-11-21-13-23-17/h2-4,6-7,9,11-13H,5,8,10H2,1H3,(H,22,24,25).
What are the key properties of 6-methyl-N-(3-phenylpropyl)-2-pyrimidin-4-ylthieno[2,3-d]pyrimidin-4-amine?
6-methyl-N-(3-phenylpropyl)-2-pyrimidin-4-ylthieno[2,3-d]pyrimidin-4-amine has a molecular weight of 361.47 g/mol, XLogP of 4.50, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-N-(3-phenylpropyl)-2-pyrimidin-4-ylthieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 166119848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).