About benzene;N-cyclopropyl-6-methyl-2-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine
benzene;N-cyclopropyl-6-methyl-2-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 166120001) has the molecular formula C17H16F3N3S
and a molecular weight of 351.40 g/mol. Its IUPAC name is benzene;N-cyclopropyl-6-methyl-2-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | benzene;N-cyclopropyl-6-methyl-2-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 166120001 |
| Molecular Formula | C17H16F3N3S |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | benzene;N-cyclopropyl-6-methyl-2-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cc2c(NC3CC3)nc(C(F)(F)F)nc2s1.c1ccccc1 |
| InChI | InChI=1S/C11H10F3N3S.C6H6/c1-5-4-7-8(15-6-2-3-6)16-10(11(12,13)14)17-9(7)18-5;1-2-4-6-5-3-1/h4,6H,2-3H2,1H3,(H,15,16,17);1-6H |
| InChIKey | GZZCZTZYYIHBAI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzene;N-cyclopropyl-6-methyl-2-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;N-cyclopropyl-6-methyl-2-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of benzene;N-cyclopropyl-6-methyl-2-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine (CID 166120001) is benzene;N-cyclopropyl-6-methyl-2-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for benzene;N-cyclopropyl-6-methyl-2-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for benzene;N-cyclopropyl-6-methyl-2-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine is Cc1cc2c(NC3CC3)nc(C(F)(F)F)nc2s1.c1ccccc1.
What is the InChIKey of benzene;N-cyclopropyl-6-methyl-2-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is GZZCZTZYYIHBAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3N3S.C6H6/c1-5-4-7-8(15-6-2-3-6)16-10(11(12,13)14)17-9(7)18-5;1-2-4-6-5-3-1/h4,6H,2-3H2,1H3,(H,15,16,17);1-6H.
What are the key properties of benzene;N-cyclopropyl-6-methyl-2-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine?
benzene;N-cyclopropyl-6-methyl-2-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 351.40 g/mol, XLogP of 5.28, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;N-cyclopropyl-6-methyl-2-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 166120001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).