C25H27FN6O2 — CID 166120337
5-[[4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)-1,3-oxazol-2-yl]amino]-2-piperazin-1-ylbenzonitrile (PubChem CID 166120337) has the molecular formula C25H27FN6O2 and a molecular weight of 462.53 g/mol. Its IUPAC name is 5-[[4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)-1,3-oxazol-2-yl]amino]-2-piperazin-1-ylbenzonitrile.
| Compound Name | 5-[[4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)-1,3-oxazol-2-yl]amino]-2-piperazin-1-ylbenzonitrile |
|---|---|
| PubChem CID | 166120337 |
| Molecular Formula | C25H27FN6O2 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 5-[[4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)-1,3-oxazol-2-yl]amino]-2-piperazin-1-ylbenzonitrile |
| SMILES | CC(C)N1CCOc2c(F)cc(-c3coc(Nc4ccc(N5CCNCC5)c(C#N)c4)n3)cc21 |
| InChI | InChI=1S/C25H27FN6O2/c1-16(2)32-9-10-33-24-20(26)12-17(13-23(24)32)21-15-34-25(30-21)29-19-3-4-22(18(11-19)14-27)31-7-5-28-6-8-31/h3-4,11-13,15-16,28H,5-10H2,1-2H3,(H,29,30) |
| InChIKey | VONMYWONZSGSCF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|