About ethane;N'-ethyl-N'-[(2E)-2-[(prop-2-enylideneamino)methylidene]butyl]ethane-1,2-diamine
ethane;N'-ethyl-N'-[(2E)-2-[(prop-2-enylideneamino)methylidene]butyl]ethane-1,2-diamine (PubChem CID 166120619) has the molecular formula C14H29N3
and a molecular weight of 239.41 g/mol. Its IUPAC name is ethane;N'-ethyl-N'-[(2E)-2-[(prop-2-enylideneamino)methylidene]butyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | ethane;N'-ethyl-N'-[(2E)-2-[(prop-2-enylideneamino)methylidene]butyl]ethane-1,2-diamine |
| PubChem CID | 166120619 |
| Molecular Formula | C14H29N3 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.24 |
| IUPAC Name | ethane;N'-ethyl-N'-[(2E)-2-[(prop-2-enylideneamino)methylidene]butyl]ethane-1,2-diamine |
| SMILES | C=C/C=N/C=C(\CC)CN(CC)CCN.CC |
| InChI | InChI=1S/C12H23N3.C2H6/c1-4-8-14-10-12(5-2)11-15(6-3)9-7-13;1-2/h4,8,10H,1,5-7,9,11,13H2,2-3H3;1-2H3/b12-10+,14-8+; |
| InChIKey | MZFGJSAFEXEGEC-KVVWYCEISA-N |
| XLogP | 2.84 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;N'-ethyl-N'-[(2E)-2-[(prop-2-enylideneamino)methylidene]butyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N'-ethyl-N'-[(2E)-2-[(prop-2-enylideneamino)methylidene]butyl]ethane-1,2-diamine?
The IUPAC name of ethane;N'-ethyl-N'-[(2E)-2-[(prop-2-enylideneamino)methylidene]butyl]ethane-1,2-diamine (CID 166120619) is ethane;N'-ethyl-N'-[(2E)-2-[(prop-2-enylideneamino)methylidene]butyl]ethane-1,2-diamine.
What is the SMILES notation for ethane;N'-ethyl-N'-[(2E)-2-[(prop-2-enylideneamino)methylidene]butyl]ethane-1,2-diamine?
The canonical SMILES for ethane;N'-ethyl-N'-[(2E)-2-[(prop-2-enylideneamino)methylidene]butyl]ethane-1,2-diamine is C=C/C=N/C=C(\CC)CN(CC)CCN.CC.
What is the InChIKey of ethane;N'-ethyl-N'-[(2E)-2-[(prop-2-enylideneamino)methylidene]butyl]ethane-1,2-diamine?
The InChIKey is MZFGJSAFEXEGEC-KVVWYCEISA-N. The full InChI is InChI=1S/C12H23N3.C2H6/c1-4-8-14-10-12(5-2)11-15(6-3)9-7-13;1-2/h4,8,10H,1,5-7,9,11,13H2,2-3H3;1-2H3/b12-10+,14-8+;.
What are the key properties of ethane;N'-ethyl-N'-[(2E)-2-[(prop-2-enylideneamino)methylidene]butyl]ethane-1,2-diamine?
ethane;N'-ethyl-N'-[(2E)-2-[(prop-2-enylideneamino)methylidene]butyl]ethane-1,2-diamine has a molecular weight of 239.41 g/mol, XLogP of 2.84, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N'-ethyl-N'-[(2E)-2-[(prop-2-enylideneamino)methylidene]butyl]ethane-1,2-diamine is sourced from PubChem (CID 166120619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).