C27H28F2N6O2 — CID 166120867
5-fluoro-7-[5-fluoro-2-(3-methoxy-4-piperazin-1-ylanilino)pyrimidin-4-yl]-1-propan-2-ylquinolin-4-one (PubChem CID 166120867) has the molecular formula C27H28F2N6O2 and a molecular weight of 506.56 g/mol. Its IUPAC name is 5-fluoro-7-[5-fluoro-2-(3-methoxy-4-piperazin-1-ylanilino)pyrimidin-4-yl]-1-propan-2-ylquinolin-4-one.
| Compound Name | 5-fluoro-7-[5-fluoro-2-(3-methoxy-4-piperazin-1-ylanilino)pyrimidin-4-yl]-1-propan-2-ylquinolin-4-one |
|---|---|
| PubChem CID | 166120867 |
| Molecular Formula | C27H28F2N6O2 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 5-fluoro-7-[5-fluoro-2-(3-methoxy-4-piperazin-1-ylanilino)pyrimidin-4-yl]-1-propan-2-ylquinolin-4-one |
| SMILES | COc1cc(Nc2ncc(F)c(-c3cc(F)c4c(=O)ccn(C(C)C)c4c3)n2)ccc1N1CCNCC1 |
| InChI | InChI=1S/C27H28F2N6O2/c1-16(2)35-9-6-23(36)25-19(28)12-17(13-22(25)35)26-20(29)15-31-27(33-26)32-18-4-5-21(24(14-18)37-3)34-10-7-30-8-11-34/h4-6,9,12-16,30H,7-8,10-11H2,1-3H3,(H,31,32,33) |
| InChIKey | NLDYWKKRULWQQC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|