C20H15F2N3O2S — CID 16612114
5-(4-fluorophenyl)-3-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 16612114) has the molecular formula C20H15F2N3O2S and a molecular weight of 399.42 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-3-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(4-fluorophenyl)-3-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 16612114 |
| Molecular Formula | C20H15F2N3O2S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 5-(4-fluorophenyl)-3-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(F)cc2)NC(=O)N(Cc2csc(-c3ccc(F)cc3)n2)C1=O |
| InChI | InChI=1S/C20H15F2N3O2S/c1-20(13-4-8-15(22)9-5-13)18(26)25(19(27)24-20)10-16-11-28-17(23-16)12-2-6-14(21)7-3-12/h2-9,11H,10H2,1H3,(H,24,27) |
| InChIKey | DLAPIJORYDZIAZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|