C18H27BN2O3 — CID 166121934
1-cyclobutyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyran-6-yl]pyrazole (PubChem CID 166121934) has the molecular formula C18H27BN2O3 and a molecular weight of 330.24 g/mol. Its IUPAC name is 1-cyclobutyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyran-6-yl]pyrazole.
| Compound Name | 1-cyclobutyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyran-6-yl]pyrazole |
|---|---|
| PubChem CID | 166121934 |
| Molecular Formula | C18H27BN2O3 |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 1-cyclobutyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyran-6-yl]pyrazole |
| SMILES | CC1(C)OB(C2=CC(c3cnn(C4CCC4)c3)OCC2)OC1(C)C |
| InChI | InChI=1S/C18H27BN2O3/c1-17(2)18(3,4)24-19(23-17)14-8-9-22-16(10-14)13-11-20-21(12-13)15-6-5-7-15/h10-12,15-16H,5-9H2,1-4H3 |
| InChIKey | GKYCWCGXLGZPES-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|