About 2-cyclopropyl-5-[(2S)-oxan-2-yl]-1,3-oxazole;N-[(Z)-3-fluoroprop-2-enylidene]methanimidamide
2-cyclopropyl-5-[(2S)-oxan-2-yl]-1,3-oxazole;N-[(Z)-3-fluoroprop-2-enylidene]methanimidamide (PubChem CID 166122173) has the molecular formula C15H20FN3O2
and a molecular weight of 293.34 g/mol. Its IUPAC name is 2-cyclopropyl-5-[(2S)-oxan-2-yl]-1,3-oxazole;N-[(Z)-3-fluoroprop-2-enylidene]methanimidamide.
Molecular Properties
| Compound Name | 2-cyclopropyl-5-[(2S)-oxan-2-yl]-1,3-oxazole;N-[(Z)-3-fluoroprop-2-enylidene]methanimidamide |
| PubChem CID | 166122173 |
| Molecular Formula | C15H20FN3O2 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 2-cyclopropyl-5-[(2S)-oxan-2-yl]-1,3-oxazole;N-[(Z)-3-fluoroprop-2-enylidene]methanimidamide |
| SMILES | [H]/N=C/N=C/C=C\F.c1nc(C2CC2)oc1[C@@H]1CCCCO1 |
| InChI | InChI=1S/C11H15NO2.C4H5FN2/c1-2-6-13-9(3-1)10-7-12-11(14-10)8-4-5-8;5-2-1-3-7-4-6/h7-9H,1-6H2;1-4,6H/b;2-1-,6-4+,7-3+/t9-;/m0./s1 |
| InChIKey | KIZFIPZYTUCIKK-IUXMVSOJSA-N |
| XLogP | 3.94 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopropyl-5-[(2S)-oxan-2-yl]-1,3-oxazole;N-[(Z)-3-fluoroprop-2-enylidene]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-5-[(2S)-oxan-2-yl]-1,3-oxazole;N-[(Z)-3-fluoroprop-2-enylidene]methanimidamide?
The IUPAC name of 2-cyclopropyl-5-[(2S)-oxan-2-yl]-1,3-oxazole;N-[(Z)-3-fluoroprop-2-enylidene]methanimidamide (CID 166122173) is 2-cyclopropyl-5-[(2S)-oxan-2-yl]-1,3-oxazole;N-[(Z)-3-fluoroprop-2-enylidene]methanimidamide.
What is the SMILES notation for 2-cyclopropyl-5-[(2S)-oxan-2-yl]-1,3-oxazole;N-[(Z)-3-fluoroprop-2-enylidene]methanimidamide?
The canonical SMILES for 2-cyclopropyl-5-[(2S)-oxan-2-yl]-1,3-oxazole;N-[(Z)-3-fluoroprop-2-enylidene]methanimidamide is [H]/N=C/N=C/C=C\F.c1nc(C2CC2)oc1[C@@H]1CCCCO1.
What is the InChIKey of 2-cyclopropyl-5-[(2S)-oxan-2-yl]-1,3-oxazole;N-[(Z)-3-fluoroprop-2-enylidene]methanimidamide?
The InChIKey is KIZFIPZYTUCIKK-IUXMVSOJSA-N. The full InChI is InChI=1S/C11H15NO2.C4H5FN2/c1-2-6-13-9(3-1)10-7-12-11(14-10)8-4-5-8;5-2-1-3-7-4-6/h7-9H,1-6H2;1-4,6H/b;2-1-,6-4+,7-3+/t9-;/m0./s1.
What are the key properties of 2-cyclopropyl-5-[(2S)-oxan-2-yl]-1,3-oxazole;N-[(Z)-3-fluoroprop-2-enylidene]methanimidamide?
2-cyclopropyl-5-[(2S)-oxan-2-yl]-1,3-oxazole;N-[(Z)-3-fluoroprop-2-enylidene]methanimidamide has a molecular weight of 293.34 g/mol, XLogP of 3.94, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-5-[(2S)-oxan-2-yl]-1,3-oxazole;N-[(Z)-3-fluoroprop-2-enylidene]methanimidamide is sourced from PubChem (CID 166122173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).