C12H12N2O — CID 166122379
7-(oxolan-3-yl)-1,6-naphthyridine (PubChem CID 166122379) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is 7-(oxolan-3-yl)-1,6-naphthyridine.
| Compound Name | 7-(oxolan-3-yl)-1,6-naphthyridine |
|---|---|
| PubChem CID | 166122379 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 7-(oxolan-3-yl)-1,6-naphthyridine |
| SMILES | c1cnc2cc(C3CCOC3)ncc2c1 |
| InChI | InChI=1S/C12H12N2O/c1-2-9-7-14-12(6-11(9)13-4-1)10-3-5-15-8-10/h1-2,4,6-7,10H,3,5,8H2 |
| InChIKey | UGFLYKSFHXCISI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |