C17H17ClN4S — CID 16612332
2-chloro-3-[(5-cyclopropyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-7,8-dimethylquinoline (PubChem CID 16612332) has the molecular formula C17H17ClN4S and a molecular weight of 344.87 g/mol. Its IUPAC name is 2-chloro-3-[(5-cyclopropyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-7,8-dimethylquinoline.
| Compound Name | 2-chloro-3-[(5-cyclopropyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-7,8-dimethylquinoline |
|---|---|
| PubChem CID | 16612332 |
| Molecular Formula | C17H17ClN4S |
| Molecular Weight | 344.87 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2-chloro-3-[(5-cyclopropyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-7,8-dimethylquinoline |
| SMILES | Cc1ccc2cc(CSc3n[nH]c(C4CC4)n3)c(Cl)nc2c1C |
| InChI | InChI=1S/C17H17ClN4S/c1-9-3-4-12-7-13(15(18)19-14(12)10(9)2)8-23-17-20-16(21-22-17)11-5-6-11/h3-4,7,11H,5-6,8H2,1-2H3,(H,20,21,22) |
| InChIKey | SKWUEUBOWXPGSI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.87 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|