C31H29F3N4O6S — CID 166124917
(2S,4S)-1-[2-(difluoromethyl)-[1]benzofuro[3,2-d]pyrimidin-4-yl]-4-[[5-ethynyl-3-[(4R,5R)-4-fluoro-2,2,5-trimethyl-1,1-dioxothian-4-yl]-2-pyridinyl]oxy]pyrrolidine-2-carboxylic acid (PubChem CID 166124917) has the molecular formula C31H29F3N4O6S and a molecular weight of 642.66 g/mol. Its IUPAC name is (2S,4S)-1-[2-(difluoromethyl)-[1]benzofuro[3,2-d]pyrimidin-4-yl]-4-[[5-ethynyl-3-[(4R,5R)-4-fluoro-2,2,5-trimethyl-1,1-dioxothian-4-yl]-2-pyridinyl]oxy]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-1-[2-(difluoromethyl)-[1]benzofuro[3,2-d]pyrimidin-4-yl]-4-[[5-ethynyl-3-[(4R,5R)-4-fluoro-2,2,5-trimethyl-1,1-dioxothian-4-yl]-2-pyridinyl]oxy]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 166124917 |
| Molecular Formula | C31H29F3N4O6S |
| Molecular Weight | 642.66 g/mol |
| Exact Mass | 642.18 |
| IUPAC Name | (2S,4S)-1-[2-(difluoromethyl)-[1]benzofuro[3,2-d]pyrimidin-4-yl]-4-[[5-ethynyl-3-[(4R,5R)-4-fluoro-2,2,5-trimethyl-1,1-dioxothian-4-yl]-2-pyridinyl]oxy]pyrrolidine-2-carboxylic acid |
| SMILES | C#Cc1cnc(O[C@H]2C[C@@H](C(=O)O)N(c3nc(C(F)F)nc4c3oc3ccccc34)C2)c([C@@]2(F)CC(C)(C)S(=O)(=O)C[C@@H]2C)c1 |
| InChI | InChI=1S/C31H29F3N4O6S/c1-5-17-10-20(31(34)15-30(3,4)45(41,42)14-16(31)2)28(35-12-17)43-18-11-21(29(39)40)38(13-18)27-24-23(36-26(37-27)25(32)33)19-8-6-7-9-22(19)44-24/h1,6-10,12,16,18,21,25H,11,13-15H2,2-4H3,(H,39,40)/t16-,18-,21-,31+/m0/s1 |
| InChIKey | FGMKSHZGNWXOJA-IDDVCLSOSA-N |
| XLogP | 5.20 |
| TPSA | 135.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.66 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|