About (4R)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-2,2-dimethylthiane 1,1-dioxide
(4R)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-2,2-dimethylthiane 1,1-dioxide (PubChem CID 166124992) has the molecular formula C12H14ClF2NO2S
and a molecular weight of 309.77 g/mol. Its IUPAC name is (4R)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-2,2-dimethylthiane 1,1-dioxide.
Molecular Properties
| Compound Name | (4R)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-2,2-dimethylthiane 1,1-dioxide |
| PubChem CID | 166124992 |
| Molecular Formula | C12H14ClF2NO2S |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | (4R)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-2,2-dimethylthiane 1,1-dioxide |
| SMILES | CC1(C)C[C@@](F)(c2cc(Cl)cnc2F)CCS1(=O)=O |
| InChI | InChI=1S/C12H14ClF2NO2S/c1-11(2)7-12(15,3-4-19(11,17)18)9-5-8(13)6-16-10(9)14/h5-6H,3-4,7H2,1-2H3/t12-/m1/s1 |
| InChIKey | SCXKRYMPOZZKEK-GFCCVEGCSA-N |
| XLogP | 3.03 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-2,2-dimethylthiane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-2,2-dimethylthiane 1,1-dioxide?
The IUPAC name of (4R)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-2,2-dimethylthiane 1,1-dioxide (CID 166124992) is (4R)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-2,2-dimethylthiane 1,1-dioxide.
What is the SMILES notation for (4R)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-2,2-dimethylthiane 1,1-dioxide?
The canonical SMILES for (4R)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-2,2-dimethylthiane 1,1-dioxide is CC1(C)C[C@@](F)(c2cc(Cl)cnc2F)CCS1(=O)=O.
What is the InChIKey of (4R)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-2,2-dimethylthiane 1,1-dioxide?
The InChIKey is SCXKRYMPOZZKEK-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H14ClF2NO2S/c1-11(2)7-12(15,3-4-19(11,17)18)9-5-8(13)6-16-10(9)14/h5-6H,3-4,7H2,1-2H3/t12-/m1/s1.
What are the key properties of (4R)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-2,2-dimethylthiane 1,1-dioxide?
(4R)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-2,2-dimethylthiane 1,1-dioxide has a molecular weight of 309.77 g/mol, XLogP of 3.03, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-2,2-dimethylthiane 1,1-dioxide is sourced from PubChem (CID 166124992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).