About CID 166125008
CID 166125008 (PubChem CID 166125008) has the molecular formula C35H44BF2N4O6
and a molecular weight of 665.57 g/mol.
Molecular Properties
| Compound Name | CID 166125008 |
| PubChem CID | 166125008 |
| Molecular Formula | C35H44BF2N4O6 |
| Molecular Weight | 665.57 g/mol |
| Exact Mass | 665.33 |
| IUPAC Name | — |
| SMILES | C#CO.CC1COCCC1(C)c1cc([B]OC(C)(C)C(C)(C)O)c[nH]c1=O.FC(F)c1nc(N2CCCC2)c2oc3ccccc3c2n1 |
| InChI | InChI=1S/C18H29BNO4.C15H13F2N3O.C2H2O/c1-12-11-23-8-7-18(12,6)14-9-13(10-20-15(14)21)19-24-17(4,5)16(2,3)22;16-13(17)14-18-11-9-5-1-2-6-10(9)21-12(11)15(19-14)20-7-3-4-8-20;1-2-3/h9-10,12,22H,7-8,11H2,1-6H3,(H,20,21);1-2,5-6,13H,3-4,7-8H2;1,3H |
| InChIKey | VXHZMYVFOKNEQS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 133.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 665.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 166125008 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166125008?
The IUPAC name of CID 166125008 (CID 166125008) is not available.
What is the SMILES notation for CID 166125008?
The canonical SMILES for CID 166125008 is C#CO.CC1COCCC1(C)c1cc([B]OC(C)(C)C(C)(C)O)c[nH]c1=O.FC(F)c1nc(N2CCCC2)c2oc3ccccc3c2n1.
What is the InChIKey of CID 166125008?
The InChIKey is VXHZMYVFOKNEQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29BNO4.C15H13F2N3O.C2H2O/c1-12-11-23-8-7-18(12,6)14-9-13(10-20-15(14)21)19-24-17(4,5)16(2,3)22;16-13(17)14-18-11-9-5-1-2-6-10(9)21-12(11)15(19-14)20-7-3-4-8-20;1-2-3/h9-10,12,22H,7-8,11H2,1-6H3,(H,20,21);1-2,5-6,13H,3-4,7-8H2;1,3H.
What are the key properties of CID 166125008?
CID 166125008 has a molecular weight of 665.57 g/mol, XLogP of 5.36, 7 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166125008 is sourced from PubChem (CID 166125008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).