About (2Z,4Z)-4-(4-fluoro-1-oxothian-4-yl)-2-methylhexa-2,4-dien-1-imine
(2Z,4Z)-4-(4-fluoro-1-oxothian-4-yl)-2-methylhexa-2,4-dien-1-imine (PubChem CID 166125096) has the molecular formula C12H18FNOS
and a molecular weight of 243.35 g/mol. Its IUPAC name is (2Z,4Z)-4-(4-fluoro-1-oxothian-4-yl)-2-methylhexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | (2Z,4Z)-4-(4-fluoro-1-oxothian-4-yl)-2-methylhexa-2,4-dien-1-imine |
| PubChem CID | 166125096 |
| Molecular Formula | C12H18FNOS |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | (2Z,4Z)-4-(4-fluoro-1-oxothian-4-yl)-2-methylhexa-2,4-dien-1-imine |
| SMILES | [H]/N=C/C(C)=C\C(=C\C)C1(F)CCS(=O)CC1 |
| InChI | InChI=1S/C12H18FNOS/c1-3-11(8-10(2)9-14)12(13)4-6-16(15)7-5-12/h3,8-9,14H,4-7H2,1-2H3/b10-8-,11-3-,14-9+ |
| InChIKey | HEAWTQWFPWGDEG-AKYCEFJLSA-N |
| XLogP | 2.78 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-4-(4-fluoro-1-oxothian-4-yl)-2-methylhexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-4-(4-fluoro-1-oxothian-4-yl)-2-methylhexa-2,4-dien-1-imine?
The IUPAC name of (2Z,4Z)-4-(4-fluoro-1-oxothian-4-yl)-2-methylhexa-2,4-dien-1-imine (CID 166125096) is (2Z,4Z)-4-(4-fluoro-1-oxothian-4-yl)-2-methylhexa-2,4-dien-1-imine.
What is the SMILES notation for (2Z,4Z)-4-(4-fluoro-1-oxothian-4-yl)-2-methylhexa-2,4-dien-1-imine?
The canonical SMILES for (2Z,4Z)-4-(4-fluoro-1-oxothian-4-yl)-2-methylhexa-2,4-dien-1-imine is [H]/N=C/C(C)=C\C(=C\C)C1(F)CCS(=O)CC1.
What is the InChIKey of (2Z,4Z)-4-(4-fluoro-1-oxothian-4-yl)-2-methylhexa-2,4-dien-1-imine?
The InChIKey is HEAWTQWFPWGDEG-AKYCEFJLSA-N. The full InChI is InChI=1S/C12H18FNOS/c1-3-11(8-10(2)9-14)12(13)4-6-16(15)7-5-12/h3,8-9,14H,4-7H2,1-2H3/b10-8-,11-3-,14-9+.
What are the key properties of (2Z,4Z)-4-(4-fluoro-1-oxothian-4-yl)-2-methylhexa-2,4-dien-1-imine?
(2Z,4Z)-4-(4-fluoro-1-oxothian-4-yl)-2-methylhexa-2,4-dien-1-imine has a molecular weight of 243.35 g/mol, XLogP of 2.78, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-4-(4-fluoro-1-oxothian-4-yl)-2-methylhexa-2,4-dien-1-imine is sourced from PubChem (CID 166125096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).