C29H29F3N4O5 — CID 166125141
5-ethynyl-3-[(3R)-3-methyloxan-4-yl]-1H-pyridin-2-one;formic acid;4-pyrrolidin-1-yl-2-(trifluoromethyl)-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 166125141) has the molecular formula C29H29F3N4O5 and a molecular weight of 570.57 g/mol. Its IUPAC name is 5-ethynyl-3-[(3R)-3-methyloxan-4-yl]-1H-pyridin-2-one;formic acid;4-pyrrolidin-1-yl-2-(trifluoromethyl)-[1]benzofuro[3,2-d]pyrimidine.
| Compound Name | 5-ethynyl-3-[(3R)-3-methyloxan-4-yl]-1H-pyridin-2-one;formic acid;4-pyrrolidin-1-yl-2-(trifluoromethyl)-[1]benzofuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 166125141 |
| Molecular Formula | C29H29F3N4O5 |
| Molecular Weight | 570.57 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | 5-ethynyl-3-[(3R)-3-methyloxan-4-yl]-1H-pyridin-2-one;formic acid;4-pyrrolidin-1-yl-2-(trifluoromethyl)-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | C#Cc1c[nH]c(=O)c(C2CCOC[C@@H]2C)c1.FC(F)(F)c1nc(N2CCCC2)c2oc3ccccc3c2n1.O=CO |
| InChI | InChI=1S/C15H12F3N3O.C13H15NO2.CH2O2/c16-15(17,18)14-19-11-9-5-1-2-6-10(9)22-12(11)13(20-14)21-7-3-4-8-21;1-3-10-6-12(13(15)14-7-10)11-4-5-16-8-9(11)2;2-1-3/h1-2,5-6H,3-4,7-8H2;1,6-7,9,11H,4-5,8H2,2H3,(H,14,15);1H,(H,2,3)/t;9-,11?;/m.0./s1 |
| InChIKey | HRLREXSEIRLYLA-KGCKYWQESA-N |
| XLogP | 5.19 |
| TPSA | 121.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|