C25H16ClF5N8O3S — CID 166125324
2-chloro-5-[1-[5-ethylsulfonyl-6-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridin-2-yl]-2-pyridinyl]-5-oxo-1,2,4-triazol-4-yl]benzonitrile (PubChem CID 166125324) has the molecular formula C25H16ClF5N8O3S and a molecular weight of 638.97 g/mol. Its IUPAC name is 2-chloro-5-[1-[5-ethylsulfonyl-6-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridin-2-yl]-2-pyridinyl]-5-oxo-1,2,4-triazol-4-yl]benzonitrile.
| Compound Name | 2-chloro-5-[1-[5-ethylsulfonyl-6-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridin-2-yl]-2-pyridinyl]-5-oxo-1,2,4-triazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 166125324 |
| Molecular Formula | C25H16ClF5N8O3S |
| Molecular Weight | 638.97 g/mol |
| Exact Mass | 638.07 |
| IUPAC Name | 2-chloro-5-[1-[5-ethylsulfonyl-6-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridin-2-yl]-2-pyridinyl]-5-oxo-1,2,4-triazol-4-yl]benzonitrile |
| SMILES | CCS(=O)(=O)c1ccc(-n2ncn(-c3ccc(Cl)c(C#N)c3)c2=O)nc1-c1nc2cc(C(F)(F)C(F)(F)F)cnc2n1C |
| InChI | InChI=1S/C25H16ClF5N8O3S/c1-3-43(41,42)18-6-7-19(39-23(40)38(12-34-39)15-4-5-16(26)13(8-15)10-32)36-20(18)22-35-17-9-14(11-33-21(17)37(22)2)24(27,28)25(29,30)31/h4-9,11-12H,3H2,1-2H3 |
| InChIKey | UKPUCZGIZADGNU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 141.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.97 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|