C37H56N8O4S — CID 166125365
2-[4-[(7-tert-butyl-5-oxothiochromeno[2,3-b]pyridin-2-yl)methyl]-7,10-bis[2-(ethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]-N-ethylacetamide (PubChem CID 166125365) has the molecular formula C37H56N8O4S and a molecular weight of 708.97 g/mol. Its IUPAC name is 2-[4-[(7-tert-butyl-5-oxothiochromeno[2,3-b]pyridin-2-yl)methyl]-7,10-bis[2-(ethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]-N-ethylacetamide.
| Compound Name | 2-[4-[(7-tert-butyl-5-oxothiochromeno[2,3-b]pyridin-2-yl)methyl]-7,10-bis[2-(ethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 166125365 |
| Molecular Formula | C37H56N8O4S |
| Molecular Weight | 708.97 g/mol |
| Exact Mass | 708.41 |
| IUPAC Name | 2-[4-[(7-tert-butyl-5-oxothiochromeno[2,3-b]pyridin-2-yl)methyl]-7,10-bis[2-(ethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)CN1CCN(CC(=O)NCC)CCN(Cc2ccc3c(=O)c4cc(C(C)(C)C)ccc4sc3n2)CCN(CC(=O)NCC)CC1 |
| InChI | InChI=1S/C37H56N8O4S/c1-7-38-32(46)24-43-16-14-42(15-17-44(25-33(47)39-8-2)19-21-45(20-18-43)26-34(48)40-9-3)23-28-11-12-29-35(49)30-22-27(37(4,5)6)10-13-31(30)50-36(29)41-28/h10-13,22H,7-9,14-21,23-26H2,1-6H3,(H,38,46)(H,39,47)(H,40,48) |
| InChIKey | HYTOCBGYVHFXNM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 130.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.97 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|