About 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal
4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal (PubChem CID 166125541) has the molecular formula C14H19NO3
and a molecular weight of 249.31 g/mol. Its IUPAC name is 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal.
Molecular Properties
| Compound Name | 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal |
| PubChem CID | 166125541 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal |
| SMILES | COc1cc2c(c(OCCCC=O)c1)CC(N)C2 |
| InChI | InChI=1S/C14H19NO3/c1-17-12-7-10-6-11(15)8-13(10)14(9-12)18-5-3-2-4-16/h4,7,9,11H,2-3,5-6,8,15H2,1H3 |
| InChIKey | QZMSFZZFCVJTIN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal?
The IUPAC name of 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal (CID 166125541) is 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal.
What is the SMILES notation for 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal?
The canonical SMILES for 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal is COc1cc2c(c(OCCCC=O)c1)CC(N)C2.
What is the InChIKey of 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal?
The InChIKey is QZMSFZZFCVJTIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3/c1-17-12-7-10-6-11(15)8-13(10)14(9-12)18-5-3-2-4-16/h4,7,9,11H,2-3,5-6,8,15H2,1H3.
What are the key properties of 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal?
4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal has a molecular weight of 249.31 g/mol, XLogP of 1.48, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal is sourced from PubChem (CID 166125541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).