C12H15NO2 — CID 166125808
1-[(2-amino-2,3-dihydro-1H-inden-4-yl)oxy]propan-2-one (PubChem CID 166125808) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-[(2-amino-2,3-dihydro-1H-inden-4-yl)oxy]propan-2-one.
| Compound Name | 1-[(2-amino-2,3-dihydro-1H-inden-4-yl)oxy]propan-2-one |
|---|---|
| PubChem CID | 166125808 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 1-[(2-amino-2,3-dihydro-1H-inden-4-yl)oxy]propan-2-one |
| SMILES | CC(=O)COc1cccc2c1CC(N)C2 |
| InChI | InChI=1S/C12H15NO2/c1-8(14)7-15-12-4-2-3-9-5-10(13)6-11(9)12/h2-4,10H,5-7,13H2,1H3 |
| InChIKey | KYZHYGYJFLLGSQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |