C24H28N2O4 — CID 166125896
2-[2-amino-7-[2-[[2-amino-1-(2-oxoethyl)-2,3-dihydro-1H-inden-4-yl]oxy]ethoxy]-2,3-dihydro-1H-inden-1-yl]acetaldehyde (PubChem CID 166125896) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is 2-[2-amino-7-[2-[[2-amino-1-(2-oxoethyl)-2,3-dihydro-1H-inden-4-yl]oxy]ethoxy]-2,3-dihydro-1H-inden-1-yl]acetaldehyde.
| Compound Name | 2-[2-amino-7-[2-[[2-amino-1-(2-oxoethyl)-2,3-dihydro-1H-inden-4-yl]oxy]ethoxy]-2,3-dihydro-1H-inden-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 166125896 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-[2-amino-7-[2-[[2-amino-1-(2-oxoethyl)-2,3-dihydro-1H-inden-4-yl]oxy]ethoxy]-2,3-dihydro-1H-inden-1-yl]acetaldehyde |
| SMILES | NC1Cc2c(OCCOc3cccc4c3C(CC=O)C(N)C4)cccc2C1CC=O |
| InChI | InChI=1S/C24H28N2O4/c25-20-13-15-3-1-6-23(24(15)18(20)8-10-28)30-12-11-29-22-5-2-4-16-17(7-9-27)21(26)14-19(16)22/h1-6,9-10,17-18,20-21H,7-8,11-14,25-26H2 |
| InChIKey | QWELPCZJDAJEDZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|