C10H13N3O — CID 166126288
5-(2-methylpyrimidin-5-yl)-2-oxa-5-azabicyclo[2.2.1]heptane (PubChem CID 166126288) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 5-(2-methylpyrimidin-5-yl)-2-oxa-5-azabicyclo[2.2.1]heptane.
| Compound Name | 5-(2-methylpyrimidin-5-yl)-2-oxa-5-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 166126288 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 5-(2-methylpyrimidin-5-yl)-2-oxa-5-azabicyclo[2.2.1]heptane |
| SMILES | Cc1ncc(N2CC3CC2CO3)cn1 |
| InChI | InChI=1S/C10H13N3O/c1-7-11-3-9(4-12-7)13-5-10-2-8(13)6-14-10/h3-4,8,10H,2,5-6H2,1H3 |
| InChIKey | IJKOFQHJTYUEIY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |