C15H20O5 — CID 166126817
5-[(1E,3E)-hexa-1,3-dienyl]-2-(3-hydroxy-2-methylpropyl)-4-oxofuran-3-carboxylic acid (PubChem CID 166126817) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is 5-[(1E,3E)-hexa-1,3-dienyl]-2-(3-hydroxy-2-methylpropyl)-4-oxofuran-3-carboxylic acid.
| Compound Name | 5-[(1E,3E)-hexa-1,3-dienyl]-2-(3-hydroxy-2-methylpropyl)-4-oxofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 166126817 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 5-[(1E,3E)-hexa-1,3-dienyl]-2-(3-hydroxy-2-methylpropyl)-4-oxofuran-3-carboxylic acid |
| SMILES | CC/C=C/C=C/C1OC(CC(C)CO)=C(C(=O)O)C1=O |
| InChI | InChI=1S/C15H20O5/c1-3-4-5-6-7-11-14(17)13(15(18)19)12(20-11)8-10(2)9-16/h4-7,10-11,16H,3,8-9H2,1-2H3,(H,18,19)/b5-4+,7-6+ |
| InChIKey | KFSJZGVUXBBUBN-YTXTXJHMSA-N |
| XLogP | 1.83 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|