C15H18O4 — CID 166126825
2-[(1E,3E)-hexa-1,3-dienyl]-2,6-dimethyl-6,7-dihydrofuro[3,2-c]pyran-3,4-dione (PubChem CID 166126825) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-[(1E,3E)-hexa-1,3-dienyl]-2,6-dimethyl-6,7-dihydrofuro[3,2-c]pyran-3,4-dione.
| Compound Name | 2-[(1E,3E)-hexa-1,3-dienyl]-2,6-dimethyl-6,7-dihydrofuro[3,2-c]pyran-3,4-dione |
|---|---|
| PubChem CID | 166126825 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-[(1E,3E)-hexa-1,3-dienyl]-2,6-dimethyl-6,7-dihydrofuro[3,2-c]pyran-3,4-dione |
| SMILES | CC/C=C/C=C/C1(C)OC2=C(C(=O)OC(C)C2)C1=O |
| InChI | InChI=1S/C15H18O4/c1-4-5-6-7-8-15(3)13(16)12-11(19-15)9-10(2)18-14(12)17/h5-8,10H,4,9H2,1-3H3/b6-5+,8-7+ |
| InChIKey | PNWHUIURTXUWHC-BSWSSELBSA-N |
| XLogP | 2.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|