C22H26N2O3S2 — CID 16612688
[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoate (PubChem CID 16612688) has the molecular formula C22H26N2O3S2 and a molecular weight of 430.60 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoate.
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoate |
|---|---|
| PubChem CID | 16612688 |
| Molecular Formula | C22H26N2O3S2 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoate |
| SMILES | Cc1nc(CSc2ccccc2C(=O)OCC(=O)NCCC2=CCCCC2)cs1 |
| InChI | InChI=1S/C22H26N2O3S2/c1-16-24-18(14-28-16)15-29-20-10-6-5-9-19(20)22(26)27-13-21(25)23-12-11-17-7-3-2-4-8-17/h5-7,9-10,14H,2-4,8,11-13,15H2,1H3,(H,23,25) |
| InChIKey | KDWVNIBRVWQCIN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|