C21H21N3S — CID 166127061
N,N-dimethyl-2-[4-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]phenyl]-1,3-benzothiazol-6-amine (PubChem CID 166127061) has the molecular formula C21H21N3S and a molecular weight of 347.49 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]phenyl]-1,3-benzothiazol-6-amine.
| Compound Name | N,N-dimethyl-2-[4-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]phenyl]-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 166127061 |
| Molecular Formula | C21H21N3S |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N,N-dimethyl-2-[4-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]phenyl]-1,3-benzothiazol-6-amine |
| SMILES | C=N/C=C(\C=C/C)c1ccc(-c2nc3ccc(N(C)C)cc3s2)cc1 |
| InChI | InChI=1S/C21H21N3S/c1-5-6-17(14-22-2)15-7-9-16(10-8-15)21-23-19-12-11-18(24(3)4)13-20(19)25-21/h5-14H,2H2,1,3-4H3/b6-5-,17-14+ |
| InChIKey | RYANCXFFVCUMRZ-QEVQMFJRSA-N |
| XLogP | 5.65 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|