About tert-butyl N-(3-ethylsulfanyl-2,2-dimethylpropyl)carbamate
tert-butyl N-(3-ethylsulfanyl-2,2-dimethylpropyl)carbamate (PubChem CID 166127236) has the molecular formula C12H25NO2S
and a molecular weight of 247.40 g/mol. Its IUPAC name is tert-butyl N-(3-ethylsulfanyl-2,2-dimethylpropyl)carbamate.
Analyze tert-butyl N-(3-ethylsulfanyl-2,2-dimethylpropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(3-ethylsulfanyl-2,2-dimethylpropyl)carbamate?
The IUPAC name of tert-butyl N-(3-ethylsulfanyl-2,2-dimethylpropyl)carbamate (CID 166127236) is tert-butyl N-(3-ethylsulfanyl-2,2-dimethylpropyl)carbamate.
What is the SMILES notation for tert-butyl N-(3-ethylsulfanyl-2,2-dimethylpropyl)carbamate?
The canonical SMILES for tert-butyl N-(3-ethylsulfanyl-2,2-dimethylpropyl)carbamate is CCSCC(C)(C)CNC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-(3-ethylsulfanyl-2,2-dimethylpropyl)carbamate?
The InChIKey is GJDINUVFVHHTOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2S/c1-7-16-9-12(5,6)8-13-10(14)15-11(2,3)4/h7-9H2,1-6H3,(H,13,14).
What are the key properties of tert-butyl N-(3-ethylsulfanyl-2,2-dimethylpropyl)carbamate?
tert-butyl N-(3-ethylsulfanyl-2,2-dimethylpropyl)carbamate has a molecular weight of 247.40 g/mol, XLogP of 3.29, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(3-ethylsulfanyl-2,2-dimethylpropyl)carbamate is sourced from PubChem (CID 166127236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).