C29H31F2N5O3 — CID 166127796
N-[2-(2-cyano-4-methylpyrrolidin-1-yl)-2-oxoethyl]-4,6-difluoro-N-[5-(4-formamidophenyl)pentyl]-1H-indole-2-carboxamide (PubChem CID 166127796) has the molecular formula C29H31F2N5O3 and a molecular weight of 535.60 g/mol. Its IUPAC name is N-[2-(2-cyano-4-methylpyrrolidin-1-yl)-2-oxoethyl]-4,6-difluoro-N-[5-(4-formamidophenyl)pentyl]-1H-indole-2-carboxamide.
| Compound Name | N-[2-(2-cyano-4-methylpyrrolidin-1-yl)-2-oxoethyl]-4,6-difluoro-N-[5-(4-formamidophenyl)pentyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 166127796 |
| Molecular Formula | C29H31F2N5O3 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | N-[2-(2-cyano-4-methylpyrrolidin-1-yl)-2-oxoethyl]-4,6-difluoro-N-[5-(4-formamidophenyl)pentyl]-1H-indole-2-carboxamide |
| SMILES | CC1CC(C#N)N(C(=O)CN(CCCCCc2ccc(NC=O)cc2)C(=O)c2cc3c(F)cc(F)cc3[nH]2)C1 |
| InChI | InChI=1S/C29H31F2N5O3/c1-19-11-23(15-32)36(16-19)28(38)17-35(10-4-2-3-5-20-6-8-22(9-7-20)33-18-37)29(39)27-14-24-25(31)12-21(30)13-26(24)34-27/h6-9,12-14,18-19,23,34H,2-5,10-11,16-17H2,1H3,(H,33,37) |
| InChIKey | UIGOUJXPFZOHPV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|